C26H32ClN3OS — CID 7000397
7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-(2-chlorophenothiazin-10-yl)heptan-1-one (PubChem CID 7000397) has the molecular formula C26H32ClN3OS and a molecular weight of 470.08 g/mol. Its IUPAC name is 7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-(2-chlorophenothiazin-10-yl)heptan-1-one.
| Compound Name | 7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-(2-chlorophenothiazin-10-yl)heptan-1-one |
|---|---|
| PubChem CID | 7000397 |
| Molecular Formula | C26H32ClN3OS |
| Molecular Weight | 470.08 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 7-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-1-(2-chlorophenothiazin-10-yl)heptan-1-one |
| SMILES | O=C(CCCCCCN1CCN2CCC[C@H]2C1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H32ClN3OS/c27-20-12-13-25-23(18-20)30(22-9-4-5-10-24(22)32-25)26(31)11-3-1-2-6-14-28-16-17-29-15-7-8-21(29)19-28/h4-5,9-10,12-13,18,21H,1-3,6-8,11,14-17,19H2/t21-/m0/s1 |
| InChIKey | QDZLSZKODUOQHK-NRFANRHFSA-N |
| XLogP | 6.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.08 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|