C19H19ClN2OS — CID 1114043
1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone (PubChem CID 1114043) has the molecular formula C19H19ClN2OS and a molecular weight of 358.89 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 1114043 |
| Molecular Formula | C19H19ClN2OS |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCCCC1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19ClN2OS/c20-14-8-9-18-16(12-14)22(15-6-2-3-7-17(15)24-18)19(23)13-21-10-4-1-5-11-21/h2-3,6-9,12H,1,4-5,10-11,13H2 |
| InChIKey | VBKSJLAPKJNYGO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |