C19H20Cl2N2OS — CID 2861917
1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone;hydrochloride (PubChem CID 2861917) has the molecular formula C19H20Cl2N2OS and a molecular weight of 395.36 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone;hydrochloride.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 2861917 |
| Molecular Formula | C19H20Cl2N2OS |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-2-piperidin-1-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CN1CCCCC1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19ClN2OS.ClH/c20-14-8-9-18-16(12-14)22(15-6-2-3-7-17(15)24-18)19(23)13-21-10-4-1-5-11-21;/h2-3,6-9,12H,1,4-5,10-11,13H2;1H |
| InChIKey | YFSNXMUCKBFCED-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |