C20H21ClN3O2S+ — CID 8557064
1-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]piperidin-1-ium-4-carboxamide (PubChem CID 8557064) has the molecular formula C20H21ClN3O2S+ and a molecular weight of 402.93 g/mol. Its IUPAC name is 1-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8557064 |
| Molecular Formula | C20H21ClN3O2S+ |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-[2-(2-chlorophenothiazin-10-yl)-2-oxoethyl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](CC(=O)N2c3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-14-5-6-18-16(11-14)24(15-3-1-2-4-17(15)27-18)19(25)12-23-9-7-13(8-10-23)20(22)26/h1-6,11,13H,7-10,12H2,(H2,22,26)/p+1 |
| InChIKey | LRRRDZPBRSPMID-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |