C19H18ClF3N2O2S — CID 43834407
2-morpholin-4-ium-4-yl-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone chloride (PubChem CID 43834407) has the molecular formula C19H18ClF3N2O2S and a molecular weight of 430.88 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-yl-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone chloride.
| Compound Name | 2-morpholin-4-ium-4-yl-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone chloride |
|---|---|
| PubChem CID | 43834407 |
| Molecular Formula | C19H18ClF3N2O2S |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-morpholin-4-ium-4-yl-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone chloride |
| SMILES | O=C(C[NH+]1CCOCC1)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21.[Cl-] |
| InChI | InChI=1S/C19H17F3N2O2S.ClH/c20-19(21,22)13-5-6-17-15(11-13)24(14-3-1-2-4-16(14)27-17)18(25)12-23-7-9-26-10-8-23;/h1-6,11H,7-10,12H2;1H |
| InChIKey | UMGHBNLMPSTVLF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |