C17H14F3NOS — CID 154359839
1-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-one (PubChem CID 154359839) has the molecular formula C17H14F3NOS and a molecular weight of 337.37 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-one.
| Compound Name | 1-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-one |
|---|---|
| PubChem CID | 154359839 |
| Molecular Formula | C17H14F3NOS |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-one |
| SMILES | CCCC(=O)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C17H14F3NOS/c1-2-5-16(22)21-12-6-3-4-7-14(12)23-15-9-8-11(10-13(15)21)17(18,19)20/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | YYVCYOMULLLINK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |