C20H19F3N2O2S — CID 1114039
2-(4-hydroxypiperidin-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone (PubChem CID 1114039) has the molecular formula C20H19F3N2O2S and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
|---|---|
| PubChem CID | 1114039 |
| Molecular Formula | C20H19F3N2O2S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
| SMILES | O=C(CN1CCC(O)CC1)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C20H19F3N2O2S/c21-20(22,23)13-5-6-18-16(11-13)25(15-3-1-2-4-17(15)28-18)19(27)12-24-9-7-14(26)8-10-24/h1-6,11,14,26H,7-10,12H2 |
| InChIKey | UVDALKNVPCVLTL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |