C15H9F3N2O4S — CID 90480433
[2-oxo-2-[2-(trifluoromethyl)phenothiazin-10-yl]ethyl] nitrate (PubChem CID 90480433) has the molecular formula C15H9F3N2O4S and a molecular weight of 370.31 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)phenothiazin-10-yl]ethyl] nitrate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)phenothiazin-10-yl]ethyl] nitrate |
|---|---|
| PubChem CID | 90480433 |
| Molecular Formula | C15H9F3N2O4S |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)phenothiazin-10-yl]ethyl] nitrate |
| SMILES | O=C(CO[N+](=O)[O-])N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C15H9F3N2O4S/c16-15(17,18)9-5-6-13-11(7-9)19(14(21)8-24-20(22)23)10-3-1-2-4-12(10)25-13/h1-7H,8H2 |
| InChIKey | KEAVXFTWFPXXGM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|