C20H20F3N2O2S+ — CID 5181005
2-(3-hydroxypiperidin-1-ium-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone (PubChem CID 5181005) has the molecular formula C20H20F3N2O2S+ and a molecular weight of 409.45 g/mol. Its IUPAC name is 2-(3-hydroxypiperidin-1-ium-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone.
| Compound Name | 2-(3-hydroxypiperidin-1-ium-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
|---|---|
| PubChem CID | 5181005 |
| Molecular Formula | C20H20F3N2O2S+ |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(3-hydroxypiperidin-1-ium-1-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
| SMILES | O=C(C[NH+]1CCCC(O)C1)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C20H19F3N2O2S/c21-20(22,23)13-7-8-18-16(10-13)25(15-5-1-2-6-17(15)28-18)19(27)12-24-9-3-4-14(26)11-24/h1-2,5-8,10,14,26H,3-4,9,11-12H2/p+1 |
| InChIKey | XUJBIMTWFDUREJ-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |