C25H27F3N2OS2 — CID 10255103
2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone (PubChem CID 10255103) has the molecular formula C25H27F3N2OS2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone.
| Compound Name | 2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
|---|---|
| PubChem CID | 10255103 |
| Molecular Formula | C25H27F3N2OS2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-1-[2-(trifluoromethyl)phenothiazin-10-yl]ethanone |
| SMILES | O=C(CSC[C@@H]1CCCN2CCCC[C@H]12)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C25H27F3N2OS2/c26-25(27,28)18-10-11-23-21(14-18)30(20-8-1-2-9-22(20)33-23)24(31)16-32-15-17-6-5-13-29-12-4-3-7-19(17)29/h1-2,8-11,14,17,19H,3-7,12-13,15-16H2/t17-,19+/m0/s1 |
| InChIKey | TZAHWEACXUCREL-PKOBYXMFSA-N |
| XLogP | 6.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |