C24H26F3N3OS — CID 3625600
3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one (PubChem CID 3625600) has the molecular formula C24H26F3N3OS and a molecular weight of 461.55 g/mol. Its IUPAC name is 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one.
| Compound Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one |
|---|---|
| PubChem CID | 3625600 |
| Molecular Formula | C24H26F3N3OS |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-[2-(trifluoromethyl)phenothiazin-10-yl]propan-1-one |
| SMILES | O=C(CCN1CCN2CCCCC2C1)N1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C24H26F3N3OS/c25-24(26,27)17-8-9-22-20(15-17)30(19-6-1-2-7-21(19)32-22)23(31)10-12-28-13-14-29-11-4-3-5-18(29)16-28/h1-2,6-9,15,18H,3-5,10-14,16H2 |
| InChIKey | KAVQQYSUMOZNRQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |