C30H32ClN3O9S — CID 131879772
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2-chlorophenothiazin-10-yl)propan-1-one;bis((Z)-but-2-enedioic acid) (PubChem CID 131879772) has the molecular formula C30H32ClN3O9S and a molecular weight of 646.12 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2-chlorophenothiazin-10-yl)propan-1-one;bis((Z)-but-2-enedioic acid).
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2-chlorophenothiazin-10-yl)propan-1-one;bis((Z)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 131879772 |
| Molecular Formula | C30H32ClN3O9S |
| Molecular Weight | 646.12 g/mol |
| Exact Mass | 645.15 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1-(2-chlorophenothiazin-10-yl)propan-1-one;bis((Z)-but-2-enedioic acid) |
| SMILES | O=C(CCN1CCN2CCCC2C1)N1c2ccccc2Sc2ccc(Cl)cc21.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H24ClN3OS.2C4H4O4/c23-16-7-8-21-19(14-16)26(18-5-1-2-6-20(18)28-21)22(27)9-11-24-12-13-25-10-3-4-17(25)15-24;2*5-3(6)1-2-4(7)8/h1-2,5-8,14,17H,3-4,9-13,15H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | JLQMOWXDDWBYGK-SPIKMXEPSA-N |
| XLogP | 4.06 |
| TPSA | 175.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.12 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|