C24H28F3N3S — CID 154302343
10-[3-(4-cyclopropylpiperazin-1-yl)-2-methylpropyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 154302343) has the molecular formula C24H28F3N3S and a molecular weight of 447.57 g/mol. Its IUPAC name is 10-[3-(4-cyclopropylpiperazin-1-yl)-2-methylpropyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-[3-(4-cyclopropylpiperazin-1-yl)-2-methylpropyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 154302343 |
| Molecular Formula | C24H28F3N3S |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 10-[3-(4-cyclopropylpiperazin-1-yl)-2-methylpropyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | CC(CN1CCN(C2CC2)CC1)CN1c2ccccc2Sc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C24H28F3N3S/c1-17(15-28-10-12-29(13-11-28)19-7-8-19)16-30-20-4-2-3-5-22(20)31-23-9-6-18(14-21(23)30)24(25,26)27/h2-6,9,14,17,19H,7-8,10-13,15-16H2,1H3 |
| InChIKey | UNQIIPCNVOPZRB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |