C26H35ClF3N3OS — CID 54600907
10-[3-[4-(2-butoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride (PubChem CID 54600907) has the molecular formula C26H35ClF3N3OS and a molecular weight of 530.10 g/mol. Its IUPAC name is 10-[3-[4-(2-butoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride.
| Compound Name | 10-[3-[4-(2-butoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride |
|---|---|
| PubChem CID | 54600907 |
| Molecular Formula | C26H35ClF3N3OS |
| Molecular Weight | 530.10 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 10-[3-[4-(2-butoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride |
| SMILES | CCCCOCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1.Cl |
| InChI | InChI=1S/C26H34F3N3OS.ClH/c1-2-3-18-33-19-17-31-15-13-30(14-16-31)11-6-12-32-22-7-4-5-8-24(22)34-25-10-9-21(20-23(25)32)26(27,28)29;/h4-5,7-10,20H,2-3,6,11-19H2,1H3;1H |
| InChIKey | MFGCMPKBOIVCHG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.10 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|