C20H22ClF3N2S — CID 21333443
10-(3-pyrrolidin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine;hydrochloride (PubChem CID 21333443) has the molecular formula C20H22ClF3N2S and a molecular weight of 414.92 g/mol. Its IUPAC name is 10-(3-pyrrolidin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine;hydrochloride.
| Compound Name | 10-(3-pyrrolidin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine;hydrochloride |
|---|---|
| PubChem CID | 21333443 |
| Molecular Formula | C20H22ClF3N2S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 10-(3-pyrrolidin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc2c(c1)N(CCCN1CCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C20H21F3N2S.ClH/c21-20(22,23)15-8-9-19-17(14-15)25(13-5-12-24-10-3-4-11-24)16-6-1-2-7-18(16)26-19;/h1-2,6-9,14H,3-5,10-13H2;1H |
| InChIKey | DDFTYIKIFPEQBU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |