C35H36F3N3OS — CID 154273971
10-[3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 154273971) has the molecular formula C35H36F3N3OS and a molecular weight of 603.75 g/mol. Its IUPAC name is 10-[3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-[3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 154273971 |
| Molecular Formula | C35H36F3N3OS |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 10-[3-[4-(2-benzhydryloxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCN1CCN(CCOC(c3ccccc3)c3ccccc3)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C35H36F3N3OS/c36-35(37,38)29-16-17-33-31(26-29)41(30-14-7-8-15-32(30)43-33)19-9-18-39-20-22-40(23-21-39)24-25-42-34(27-10-3-1-4-11-27)28-12-5-2-6-13-28/h1-8,10-17,26,34H,9,18-25H2 |
| InChIKey | MZQBRPTZNAYDKW-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |