C20H22F3N3S — CID 6431810
10-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 6431810) has the molecular formula C20H22F3N3S and a molecular weight of 393.48 g/mol. Its IUPAC name is 10-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 6431810 |
| Molecular Formula | C20H22F3N3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 10-[2-(4-methylpiperazin-1-yl)ethyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | CN1CCN(CCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C20H22F3N3S/c1-24-8-10-25(11-9-24)12-13-26-16-4-2-3-5-18(16)27-19-7-6-15(14-17(19)26)20(21,22)23/h2-7,14H,8-13H2,1H3 |
| InChIKey | MHUAPXMXUVNBOO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |