C23H28F3N3S — CID 58645990
10-[3-(4-propylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 58645990) has the molecular formula C23H28F3N3S and a molecular weight of 435.56 g/mol. Its IUPAC name is 10-[3-(4-propylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-[3-(4-propylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 58645990 |
| Molecular Formula | C23H28F3N3S |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 10-[3-(4-propylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | CCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C23H28F3N3S/c1-2-10-27-13-15-28(16-14-27)11-5-12-29-19-6-3-4-7-21(19)30-22-9-8-18(17-20(22)29)23(24,25)26/h3-4,6-9,17H,2,5,10-16H2,1H3 |
| InChIKey | IHPLDUUYIYAAOR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |