C25H31ClF3N3OS — CID 54603272
10-[3-[4-(2-prop-2-enoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride (PubChem CID 54603272) has the molecular formula C25H31ClF3N3OS and a molecular weight of 514.06 g/mol. Its IUPAC name is 10-[3-[4-(2-prop-2-enoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride.
| Compound Name | 10-[3-[4-(2-prop-2-enoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride |
|---|---|
| PubChem CID | 54603272 |
| Molecular Formula | C25H31ClF3N3OS |
| Molecular Weight | 514.06 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 10-[3-[4-(2-prop-2-enoxyethyl)piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine;hydrochloride |
| SMILES | C=CCOCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1.Cl |
| InChI | InChI=1S/C25H30F3N3OS.ClH/c1-2-17-32-18-16-30-14-12-29(13-15-30)10-5-11-31-21-6-3-4-7-23(21)33-24-9-8-20(19-22(24)31)25(26,27)28;/h2-4,6-9,19H,1,5,10-18H2;1H |
| InChIKey | GTYWDSPFAMKSMH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.06 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|