C22H26F3N3S — CID 139567030
10-[4-(4-methylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 139567030) has the molecular formula C22H26F3N3S and a molecular weight of 421.53 g/mol. Its IUPAC name is 10-[4-(4-methylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-[4-(4-methylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 139567030 |
| Molecular Formula | C22H26F3N3S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 10-[4-(4-methylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | CN1CCN(CCCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H26F3N3S/c1-26-12-14-27(15-13-26)10-4-5-11-28-18-6-2-3-7-20(18)29-21-9-8-17(16-19(21)28)22(23,24)25/h2-3,6-9,16H,4-5,10-15H2,1H3 |
| InChIKey | WDTZTWNUHSPIIX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|