C27H28F3N3S — CID 135251829
10-[4-(4-phenylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine (PubChem CID 135251829) has the molecular formula C27H28F3N3S and a molecular weight of 483.60 g/mol. Its IUPAC name is 10-[4-(4-phenylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-[4-(4-phenylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 135251829 |
| Molecular Formula | C27H28F3N3S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 10-[4-(4-phenylpiperazin-1-yl)butyl]-2-(trifluoromethyl)phenothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCCN1CCN(c3ccccc3)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C27H28F3N3S/c28-27(29,30)21-12-13-26-24(20-21)33(23-10-4-5-11-25(23)34-26)15-7-6-14-31-16-18-32(19-17-31)22-8-2-1-3-9-22/h1-5,8-13,20H,6-7,14-19H2 |
| InChIKey | OOCXHTNXNVUDOJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|