C28H30F3N3O8S — CID 10175468
bis((Z)-but-2-enedioic acid);10-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine (PubChem CID 10175468) has the molecular formula C28H30F3N3O8S and a molecular weight of 625.62 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);10-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine.
| Compound Name | bis((Z)-but-2-enedioic acid);10-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 10175468 |
| Molecular Formula | C28H30F3N3O8S |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);10-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCN1CCNCC1)c1ccccc1S2.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H22F3N3S.2C4H4O4/c21-20(22,23)15-6-7-19-17(14-15)26(16-4-1-2-5-18(16)27-19)11-3-10-25-12-8-24-9-13-25;2*5-3(6)1-2-4(7)8/h1-2,4-7,14,24H,3,8-13H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | FUTUOIVJDAELFW-SPIKMXEPSA-N |
| XLogP | 4.03 |
| TPSA | 167.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|