C32H36F3N3OS — CID 142888729
(Z)-but-2-ene;2-phenyl-1-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanone (PubChem CID 142888729) has the molecular formula C32H36F3N3OS and a molecular weight of 567.72 g/mol. Its IUPAC name is (Z)-but-2-ene;2-phenyl-1-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanone.
| Compound Name | (Z)-but-2-ene;2-phenyl-1-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142888729 |
| Molecular Formula | C32H36F3N3OS |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | (Z)-but-2-ene;2-phenyl-1-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanone |
| SMILES | C/C=C\C.O=C(Cc1ccccc1)N1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C28H28F3N3OS.C4H8/c29-28(30,31)22-11-12-26-24(20-22)34(23-9-4-5-10-25(23)36-26)14-6-13-32-15-17-33(18-16-32)27(35)19-21-7-2-1-3-8-21;1-3-4-2/h1-5,7-12,20H,6,13-19H2;3-4H,1-2H3/b;4-3- |
| InChIKey | VLSCKYXIJMYANJ-QGAMPUOQSA-N |
| XLogP | 7.67 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|