C40H60F3N3O3S — CID 70357908
(Z)-octadec-9-enoic acid;2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol (PubChem CID 70357908) has the molecular formula C40H60F3N3O3S and a molecular weight of 720.00 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol.
| Compound Name | (Z)-octadec-9-enoic acid;2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 70357908 |
| Molecular Formula | C40H60F3N3O3S |
| Molecular Weight | 720.00 g/mol |
| Exact Mass | 719.43 |
| IUPAC Name | (Z)-octadec-9-enoic acid;2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.OCCN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H26F3N3OS.C18H34O2/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h1-2,4-7,16,29H,3,8-15H2;9-10H,2-8,11-17H2,1H3,(H,19,20)/b;10-9- |
| InChIKey | DKXZYVOXBUUNBI-SVMKZPJVSA-N |
| XLogP | 10.42 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.00 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|