C21H21F3N2O4S — CID 10343938
(E)-but-2-enedioic acid;4-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-amine (PubChem CID 10343938) has the molecular formula C21H21F3N2O4S and a molecular weight of 454.47 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;4-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-amine |
|---|---|
| PubChem CID | 10343938 |
| Molecular Formula | C21H21F3N2O4S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[2-(trifluoromethyl)phenothiazin-10-yl]butan-1-amine |
| SMILES | NCCCCN1c2ccccc2Sc2ccc(C(F)(F)F)cc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H17F3N2S.C4H4O4/c18-17(19,20)12-7-8-16-14(11-12)22(10-4-3-9-21)13-5-1-2-6-15(13)23-16;5-3(6)1-2-4(7)8/h1-2,5-8,11H,3-4,9-10,21H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FZXDSUKAKINDCR-WLHGVMLRSA-N |
| XLogP | 4.76 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|