C21H26F3N3S — CID 143153499
1-methylpiperazine;10-propyl-2-(trifluoromethyl)phenothiazine (PubChem CID 143153499) has the molecular formula C21H26F3N3S and a molecular weight of 409.52 g/mol. Its IUPAC name is 1-methylpiperazine;10-propyl-2-(trifluoromethyl)phenothiazine.
| Compound Name | 1-methylpiperazine;10-propyl-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 143153499 |
| Molecular Formula | C21H26F3N3S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-methylpiperazine;10-propyl-2-(trifluoromethyl)phenothiazine |
| SMILES | CCCN1c2ccccc2Sc2ccc(C(F)(F)F)cc21.CN1CCNCC1 |
| InChI | InChI=1S/C16H14F3NS.C5H12N2/c1-2-9-20-12-5-3-4-6-14(12)21-15-8-7-11(10-13(15)20)16(17,18)19;1-7-4-2-6-3-5-7/h3-8,10H,2,9H2,1H3;6H,2-5H2,1H3 |
| InChIKey | WXQHWCIQAFZWCA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |