C22H25ClF3N3S — CID 154323058
10-(5-chloro-4-piperazin-1-ylpentyl)-2-(trifluoromethyl)phenothiazine (PubChem CID 154323058) has the molecular formula C22H25ClF3N3S and a molecular weight of 455.98 g/mol. Its IUPAC name is 10-(5-chloro-4-piperazin-1-ylpentyl)-2-(trifluoromethyl)phenothiazine.
| Compound Name | 10-(5-chloro-4-piperazin-1-ylpentyl)-2-(trifluoromethyl)phenothiazine |
|---|---|
| PubChem CID | 154323058 |
| Molecular Formula | C22H25ClF3N3S |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 10-(5-chloro-4-piperazin-1-ylpentyl)-2-(trifluoromethyl)phenothiazine |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCC(CCl)N1CCNCC1)c1ccccc1S2 |
| InChI | InChI=1S/C22H25ClF3N3S/c23-15-17(28-12-9-27-10-13-28)4-3-11-29-18-5-1-2-6-20(18)30-21-8-7-16(14-19(21)29)22(24,25)26/h1-2,5-8,14,17,27H,3-4,9-13,15H2 |
| InChIKey | NBLDWAWTKONRBD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|