C29H40F3N3O3S — CID 153351332
tert-butyl 4-[2-hydroxy-3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazine-1-carboxylate;ethane;ethene (PubChem CID 153351332) has the molecular formula C29H40F3N3O3S and a molecular weight of 567.72 g/mol. Its IUPAC name is tert-butyl 4-[2-hydroxy-3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazine-1-carboxylate;ethane;ethene.
| Compound Name | tert-butyl 4-[2-hydroxy-3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazine-1-carboxylate;ethane;ethene |
|---|---|
| PubChem CID | 153351332 |
| Molecular Formula | C29H40F3N3O3S |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | tert-butyl 4-[2-hydroxy-3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazine-1-carboxylate;ethane;ethene |
| SMILES | C=C.CC.CC(C)(C)OC(=O)N1CCN(CC(O)CN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C25H30F3N3O3S.C2H6.C2H4/c1-24(2,3)34-23(33)30-12-10-29(11-13-30)15-18(32)16-31-19-6-4-5-7-21(19)35-22-9-8-17(14-20(22)31)25(26,27)28;2*1-2/h4-9,14,18,32H,10-13,15-16H2,1-3H3;1-2H3;1-2H2 |
| InChIKey | PMKBMMXOTOGJTF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|