C23H28N2O2S — CID 70077895
tert-butyl 4-(phenothiazin-10-ylmethyl)piperidine-1-carboxylate (PubChem CID 70077895) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is tert-butyl 4-(phenothiazin-10-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(phenothiazin-10-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70077895 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl 4-(phenothiazin-10-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2c3ccccc3Sc3ccccc32)CC1 |
| InChI | InChI=1S/C23H28N2O2S/c1-23(2,3)27-22(26)24-14-12-17(13-15-24)16-25-18-8-4-6-10-20(18)28-21-11-7-5-9-19(21)25/h4-11,17H,12-16H2,1-3H3 |
| InChIKey | VPDYWZMPGVIPHY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|