C23H28N2O2S — CID 140979929
tert-butyl 4-(10H-phenothiazin-1-ylmethyl)piperidine-1-carboxylate (PubChem CID 140979929) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is tert-butyl 4-(10H-phenothiazin-1-ylmethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(10H-phenothiazin-1-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140979929 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl 4-(10H-phenothiazin-1-ylmethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2cccc3c2Nc2ccccc2S3)CC1 |
| InChI | InChI=1S/C23H28N2O2S/c1-23(2,3)27-22(26)25-13-11-16(12-14-25)15-17-7-6-10-20-21(17)24-18-8-4-5-9-19(18)28-20/h4-10,16,24H,11-15H2,1-3H3 |
| InChIKey | MBMSJGNCJYYODD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |