C16H24BNO4 — CID 67451416
[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]methyl]phenyl]boronic acid (PubChem CID 67451416) has the molecular formula C16H24BNO4 and a molecular weight of 305.18 g/mol. Its IUPAC name is [2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 67451416 |
| Molecular Formula | C16H24BNO4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]methyl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2ccccc2B(O)O)C1 |
| InChI | InChI=1S/C16H24BNO4/c1-16(2,3)22-15(19)18-9-8-12(11-18)10-13-6-4-5-7-14(13)17(20)21/h4-7,12,20-21H,8-11H2,1-3H3 |
| InChIKey | XBHHLUQTTKQEMO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|