C28H33INO2P — CID 173128746
tert-butyl (3S)-3-[(3-diphenylphosphanylphenyl)methyl]pyrrolidine-1-carboxylate;hydroiodide (PubChem CID 173128746) has the molecular formula C28H33INO2P and a molecular weight of 573.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3-diphenylphosphanylphenyl)methyl]pyrrolidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl (3S)-3-[(3-diphenylphosphanylphenyl)methyl]pyrrolidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 173128746 |
| Molecular Formula | C28H33INO2P |
| Molecular Weight | 573.46 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | tert-butyl (3S)-3-[(3-diphenylphosphanylphenyl)methyl]pyrrolidine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Cc2cccc(P(c3ccccc3)c3ccccc3)c2)C1.I |
| InChI | InChI=1S/C28H32NO2P.HI/c1-28(2,3)31-27(30)29-18-17-23(21-29)19-22-11-10-16-26(20-22)32(24-12-6-4-7-13-24)25-14-8-5-9-15-25;/h4-16,20,23H,17-19,21H2,1-3H3;1H/t23-;/m1./s1 |
| InChIKey | TYFXADVFTJZARJ-GNAFDRTKSA-N |
| XLogP | 5.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|