C25H31N3O4S2 — CID 144921878
tert-butyl 4-[2-[(6-oxo-5H-benzo[b][1,4]benzothiazepin-3-yl)sulfanyloxyamino]ethyl]piperidine-1-carboxylate (PubChem CID 144921878) has the molecular formula C25H31N3O4S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is tert-butyl 4-[2-[(6-oxo-5H-benzo[b][1,4]benzothiazepin-3-yl)sulfanyloxyamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(6-oxo-5H-benzo[b][1,4]benzothiazepin-3-yl)sulfanyloxyamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144921878 |
| Molecular Formula | C25H31N3O4S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | tert-butyl 4-[2-[(6-oxo-5H-benzo[b][1,4]benzothiazepin-3-yl)sulfanyloxyamino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCNOSc2ccc3c(c2)NC(=O)c2ccccc2S3)CC1 |
| InChI | InChI=1S/C25H31N3O4S2/c1-25(2,3)31-24(30)28-14-11-17(12-15-28)10-13-26-32-34-18-8-9-22-20(16-18)27-23(29)19-6-4-5-7-21(19)33-22/h4-9,16-17,26H,10-15H2,1-3H3,(H,27,29) |
| InChIKey | DGDNRUQJMNJFHO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|