C22H24N2O2S — CID 118373380
N-(2-cyclohexylethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 118373380) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-(2-cyclohexylethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 118373380 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-(2-cyclohexylethyl)-6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCCC1CCCCC1)c1ccc2c(c1)NC(=O)c1ccccc1S2 |
| InChI | InChI=1S/C22H24N2O2S/c25-21(23-13-12-15-6-2-1-3-7-15)16-10-11-20-18(14-16)24-22(26)17-8-4-5-9-19(17)27-20/h4-5,8-11,14-15H,1-3,6-7,12-13H2,(H,23,25)(H,24,26) |
| InChIKey | HUJYMJICNZHFLE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |