C24H27NO2S — CID 160999413
3-(5-cyclohexyl-2-oxopentyl)-5H-benzo[b][1,4]benzothiazepin-6-one (PubChem CID 160999413) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is 3-(5-cyclohexyl-2-oxopentyl)-5H-benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 3-(5-cyclohexyl-2-oxopentyl)-5H-benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 160999413 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-(5-cyclohexyl-2-oxopentyl)-5H-benzo[b][1,4]benzothiazepin-6-one |
| SMILES | O=C(CCCC1CCCCC1)Cc1ccc2c(c1)NC(=O)c1ccccc1S2 |
| InChI | InChI=1S/C24H27NO2S/c26-19(10-6-9-17-7-2-1-3-8-17)15-18-13-14-23-21(16-18)25-24(27)20-11-4-5-12-22(20)28-23/h4-5,11-14,16-17H,1-3,6-10,15H2,(H,25,27) |
| InChIKey | RJOOTAWLNPROGO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |