C28H30N2O3S — CID 58293886
tert-butyl 4-(4-phenothiazin-10-ylphenoxy)piperidine-1-carboxylate (PubChem CID 58293886) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is tert-butyl 4-(4-phenothiazin-10-ylphenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-phenothiazin-10-ylphenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58293886 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | tert-butyl 4-(4-phenothiazin-10-ylphenoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(N3c4ccccc4Sc4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C28H30N2O3S/c1-28(2,3)33-27(31)29-18-16-22(17-19-29)32-21-14-12-20(13-15-21)30-23-8-4-6-10-25(23)34-26-11-7-5-9-24(26)30/h4-15,22H,16-19H2,1-3H3 |
| InChIKey | BTHMMUFKQURZEV-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |