C19H18F3NO2S — CID 150049651
pentyl 3-(trifluoromethyl)phenothiazine-10-carboxylate (PubChem CID 150049651) has the molecular formula C19H18F3NO2S and a molecular weight of 381.42 g/mol. Its IUPAC name is pentyl 3-(trifluoromethyl)phenothiazine-10-carboxylate.
| Compound Name | pentyl 3-(trifluoromethyl)phenothiazine-10-carboxylate |
|---|---|
| PubChem CID | 150049651 |
| Molecular Formula | C19H18F3NO2S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | pentyl 3-(trifluoromethyl)phenothiazine-10-carboxylate |
| SMILES | CCCCCOC(=O)N1c2ccccc2Sc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H18F3NO2S/c1-2-3-6-11-25-18(24)23-14-7-4-5-8-16(14)26-17-12-13(19(20,21)22)9-10-15(17)23/h4-5,7-10,12H,2-3,6,11H2,1H3 |
| InChIKey | DLALGAKTGXAYEO-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|