C27H37NO2S — CID 167516419
tert-butyl 2-decylphenothiazine-10-carboxylate (PubChem CID 167516419) has the molecular formula C27H37NO2S and a molecular weight of 439.67 g/mol. Its IUPAC name is tert-butyl 2-decylphenothiazine-10-carboxylate.
| Compound Name | tert-butyl 2-decylphenothiazine-10-carboxylate |
|---|---|
| PubChem CID | 167516419 |
| Molecular Formula | C27H37NO2S |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | tert-butyl 2-decylphenothiazine-10-carboxylate |
| SMILES | CCCCCCCCCCc1ccc2c(c1)N(C(=O)OC(C)(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C27H37NO2S/c1-5-6-7-8-9-10-11-12-15-21-18-19-25-23(20-21)28(26(29)30-27(2,3)4)22-16-13-14-17-24(22)31-25/h13-14,16-20H,5-12,15H2,1-4H3 |
| InChIKey | HMGFRZXSVCSCGJ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|