C31H46NNaO3S2 — CID 139603653
sodium 3-(2,8-dioctylphenothiazin-10-yl)propane-1-sulfonate (PubChem CID 139603653) has the molecular formula C31H46NNaO3S2 and a molecular weight of 567.84 g/mol. Its IUPAC name is sodium 3-(2,8-dioctylphenothiazin-10-yl)propane-1-sulfonate.
| Compound Name | sodium 3-(2,8-dioctylphenothiazin-10-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 139603653 |
| Molecular Formula | C31H46NNaO3S2 |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | sodium 3-(2,8-dioctylphenothiazin-10-yl)propane-1-sulfonate |
| SMILES | CCCCCCCCc1ccc2c(c1)N(CCCS(=O)(=O)[O-])c1cc(CCCCCCCC)ccc1S2.[Na+] |
| InChI | InChI=1S/C31H47NO3S2.Na/c1-3-5-7-9-11-13-16-26-18-20-30-28(24-26)32(22-15-23-37(33,34)35)29-25-27(19-21-31(29)36-30)17-14-12-10-8-6-4-2;/h18-21,24-25H,3-17,22-23H2,1-2H3,(H,33,34,35);/q;+1/p-1 |
| InChIKey | DSBFZUYYIOOOMH-UHFFFAOYSA-M |
| XLogP | 6.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|