C39H60N6S — CID 110189438
6-(2,8-dioctylphenothiazin-10-yl)-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine (PubChem CID 110189438) has the molecular formula C39H60N6S and a molecular weight of 645.02 g/mol. Its IUPAC name is 6-(2,8-dioctylphenothiazin-10-yl)-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,8-dioctylphenothiazin-10-yl)-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 110189438 |
| Molecular Formula | C39H60N6S |
| Molecular Weight | 645.02 g/mol |
| Exact Mass | 644.46 |
| IUPAC Name | 6-(2,8-dioctylphenothiazin-10-yl)-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCc1ccc2c(c1)N(c1nc(N(CC)CC)nc(N(CC)CC)n1)c1cc(CCCCCCCC)ccc1S2 |
| InChI | InChI=1S/C39H60N6S/c1-7-13-15-17-19-21-23-31-25-27-35-33(29-31)45(34-30-32(26-28-36(34)46-35)24-22-20-18-16-14-8-2)39-41-37(43(9-3)10-4)40-38(42-39)44(11-5)12-6/h25-30H,7-24H2,1-6H3 |
| InChIKey | JDTDKNXJRGFCQN-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.02 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|