C19H22NNaO4S — CID 139603613
sodium 3-(2,7-diethylphenoxazin-10-yl)propane-1-sulfonate (PubChem CID 139603613) has the molecular formula C19H22NNaO4S and a molecular weight of 383.45 g/mol. Its IUPAC name is sodium 3-(2,7-diethylphenoxazin-10-yl)propane-1-sulfonate.
| Compound Name | sodium 3-(2,7-diethylphenoxazin-10-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 139603613 |
| Molecular Formula | C19H22NNaO4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | sodium 3-(2,7-diethylphenoxazin-10-yl)propane-1-sulfonate |
| SMILES | CCc1ccc2c(c1)Oc1ccc(CC)cc1N2CCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H23NO4S.Na/c1-3-14-7-9-18-17(12-14)20(10-5-11-25(21,22)23)16-8-6-15(4-2)13-19(16)24-18;/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | ZUFMXTIAVPDMQO-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|