C17H16NNaO3S2 — CID 139603623
sodium 3-(2-ethenylphenothiazin-10-yl)propane-1-sulfonate (PubChem CID 139603623) has the molecular formula C17H16NNaO3S2 and a molecular weight of 369.44 g/mol. Its IUPAC name is sodium 3-(2-ethenylphenothiazin-10-yl)propane-1-sulfonate.
| Compound Name | sodium 3-(2-ethenylphenothiazin-10-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 139603623 |
| Molecular Formula | C17H16NNaO3S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | sodium 3-(2-ethenylphenothiazin-10-yl)propane-1-sulfonate |
| SMILES | C=Cc1ccc2c(c1)N(CCCS(=O)(=O)[O-])c1ccccc1S2.[Na+] |
| InChI | InChI=1S/C17H17NO3S2.Na/c1-2-13-8-9-17-15(12-13)18(10-5-11-23(19,20)21)14-6-3-4-7-16(14)22-17;/h2-4,6-9,12H,1,5,10-11H2,(H,19,20,21);/q;+1/p-1 |
| InChIKey | IQADOXRRTUEUMX-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|