C19H19ClN2S — CID 163912126
3-(2-chlorophenothiazin-10-yl)-N,N-bis(ethenyl)propan-1-amine (PubChem CID 163912126) has the molecular formula C19H19ClN2S and a molecular weight of 342.90 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)-N,N-bis(ethenyl)propan-1-amine.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)-N,N-bis(ethenyl)propan-1-amine |
|---|---|
| PubChem CID | 163912126 |
| Molecular Formula | C19H19ClN2S |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)-N,N-bis(ethenyl)propan-1-amine |
| SMILES | C=CN(C=C)CCCN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H19ClN2S/c1-3-21(4-2)12-7-13-22-16-8-5-6-9-18(16)23-19-11-10-15(20)14-17(19)22/h3-6,8-11,14H,1-2,7,12-13H2 |
| InChIKey | QTACVHNDFSZMDQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |