C19H24Cl2N2S — CID 71314834
3-(2-chlorophenothiazin-10-yl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)propan-1-amine;hydrochloride (PubChem CID 71314834) has the molecular formula C19H24Cl2N2S and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 71314834 |
| Molecular Formula | C19H24Cl2N2S |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)propan-1-amine;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C([2H])([2H])N(CCCN1c2ccccc2Sc2ccc(Cl)cc21)C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C19H23ClN2S.ClH/c1-3-21(4-2)12-7-13-22-16-8-5-6-9-18(16)23-19-11-10-15(20)14-17(19)22;/h5-6,8-11,14H,3-4,7,12-13H2,1-2H3;1H/i1D3,2D3,3D2,4D2; |
| InChIKey | XXQMDKCWUYZXOF-MFMGRUKYSA-N |
| XLogP | 6.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |