C19H24ClN2S+ — CID 4109407
3-(2-chlorophenothiazin-10-yl)propyl-diethylazanium (PubChem CID 4109407) has the molecular formula C19H24ClN2S+ and a molecular weight of 347.94 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)propyl-diethylazanium.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)propyl-diethylazanium |
|---|---|
| PubChem CID | 4109407 |
| Molecular Formula | C19H24ClN2S+ |
| Molecular Weight | 347.94 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCN1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H23ClN2S/c1-3-21(4-2)12-7-13-22-16-8-5-6-9-18(16)23-19-11-10-15(20)14-17(19)22/h5-6,8-11,14H,3-4,7,12-13H2,1-2H3/p+1 |
| InChIKey | DBOUGBAQLIXZLV-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |