C21H28BrClN2S — CID 19029743
1-(2-chlorophenothiazin-10-yl)heptan-4-yl-dimethylazanium bromide (PubChem CID 19029743) has the molecular formula C21H28BrClN2S and a molecular weight of 455.89 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)heptan-4-yl-dimethylazanium bromide.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)heptan-4-yl-dimethylazanium bromide |
|---|---|
| PubChem CID | 19029743 |
| Molecular Formula | C21H28BrClN2S |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)heptan-4-yl-dimethylazanium bromide |
| SMILES | CCCC(CCCN1c2ccccc2Sc2ccc(Cl)cc21)[NH+](C)C.[Br-] |
| InChI | InChI=1S/C21H27ClN2S.BrH/c1-4-8-17(23(2)3)9-7-14-24-18-10-5-6-11-20(18)25-21-13-12-16(22)15-19(21)24;/h5-6,10-13,15,17H,4,7-9,14H2,1-3H3;1H |
| InChIKey | QOPCJWKDLZPGCG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |