About 10-butylphenothiazine;propane
10-butylphenothiazine;propane (PubChem CID 177020956) has the molecular formula C19H25NS
and a molecular weight of 299.48 g/mol. Its IUPAC name is 10-butylphenothiazine;propane.
Molecular Properties
| Compound Name | 10-butylphenothiazine;propane |
| PubChem CID | 177020956 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 10-butylphenothiazine;propane |
| SMILES | CCC.CCCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C16H17NS.C3H8/c1-2-3-12-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17;1-3-2/h4-11H,2-3,12H2,1H3;3H2,1-2H3 |
| InChIKey | WTCAHRMAYPBFOT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze 10-butylphenothiazine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-butylphenothiazine;propane?
The IUPAC name of 10-butylphenothiazine;propane (CID 177020956) is 10-butylphenothiazine;propane.
What is the SMILES notation for 10-butylphenothiazine;propane?
The canonical SMILES for 10-butylphenothiazine;propane is CCC.CCCCN1c2ccccc2Sc2ccccc21.
What is the InChIKey of 10-butylphenothiazine;propane?
The InChIKey is WTCAHRMAYPBFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NS.C3H8/c1-2-3-12-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17;1-3-2/h4-11H,2-3,12H2,1H3;3H2,1-2H3.
What are the key properties of 10-butylphenothiazine;propane?
10-butylphenothiazine;propane has a molecular weight of 299.48 g/mol, XLogP of 6.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-butylphenothiazine;propane is sourced from PubChem (CID 177020956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).