About 10-butylphenothiazine;hydrate;tetrahydroiodide
10-butylphenothiazine;hydrate;tetrahydroiodide (PubChem CID 173485866) has the molecular formula C16H23I4NOS
and a molecular weight of 785.05 g/mol. Its IUPAC name is 10-butylphenothiazine;hydrate;tetrahydroiodide.
Molecular Properties
| Compound Name | 10-butylphenothiazine;hydrate;tetrahydroiodide |
| PubChem CID | 173485866 |
| Molecular Formula | C16H23I4NOS |
| Molecular Weight | 785.05 g/mol |
| Exact Mass | 784.77 |
| IUPAC Name | 10-butylphenothiazine;hydrate;tetrahydroiodide |
| SMILES | CCCCN1c2ccccc2Sc2ccccc21.I.I.I.I.O |
| InChI | InChI=1S/C16H17NS.4HI.H2O/c1-2-3-12-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17;;;;;/h4-11H,2-3,12H2,1H3;4*1H;1H2 |
| InChIKey | VNEXCAOTCTUPDW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 785.05 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 10-butylphenothiazine;hydrate;tetrahydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-butylphenothiazine;hydrate;tetrahydroiodide?
The IUPAC name of 10-butylphenothiazine;hydrate;tetrahydroiodide (CID 173485866) is 10-butylphenothiazine;hydrate;tetrahydroiodide.
What is the SMILES notation for 10-butylphenothiazine;hydrate;tetrahydroiodide?
The canonical SMILES for 10-butylphenothiazine;hydrate;tetrahydroiodide is CCCCN1c2ccccc2Sc2ccccc21.I.I.I.I.O.
What is the InChIKey of 10-butylphenothiazine;hydrate;tetrahydroiodide?
The InChIKey is VNEXCAOTCTUPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NS.4HI.H2O/c1-2-3-12-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17;;;;;/h4-11H,2-3,12H2,1H3;4*1H;1H2.
What are the key properties of 10-butylphenothiazine;hydrate;tetrahydroiodide?
10-butylphenothiazine;hydrate;tetrahydroiodide has a molecular weight of 785.05 g/mol, XLogP of 6.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-butylphenothiazine;hydrate;tetrahydroiodide is sourced from PubChem (CID 173485866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).