C45H45N3O3S3 — CID 102291930
2,4,6-tris[(2Z)-2-(3-butyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexane-1,3,5-trione (PubChem CID 102291930) has the molecular formula C45H45N3O3S3 and a molecular weight of 772.07 g/mol. Its IUPAC name is 2,4,6-tris[(2Z)-2-(3-butyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexane-1,3,5-trione.
| Compound Name | 2,4,6-tris[(2Z)-2-(3-butyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 102291930 |
| Molecular Formula | C45H45N3O3S3 |
| Molecular Weight | 772.07 g/mol |
| Exact Mass | 771.26 |
| IUPAC Name | 2,4,6-tris[(2Z)-2-(3-butyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexane-1,3,5-trione |
| SMILES | CCCCN1/C(=C/C=C2C(=O)C(=C/C=C3\Sc4ccccc4N3CCCC)C(=O)C(=C/C=C3\Sc4ccccc4N3CCCC)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C45H45N3O3S3/c1-4-7-28-46-34-16-10-13-19-37(34)52-40(46)25-22-31-43(49)32(23-26-41-47(29-8-5-2)35-17-11-14-20-38(35)53-41)45(51)33(44(31)50)24-27-42-48(30-9-6-3)36-18-12-15-21-39(36)54-42/h10-27H,4-9,28-30H2,1-3H3/b31-22-,32-23-,33-24-,40-25-,41-26-,42-27- |
| InChIKey | RZMXYMIEPURULH-VUFOZNLJSA-N |
| XLogP | 11.25 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.07 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|