C49H67N5O2S2 — CID 72637115
5-[2,5-bis[2-(3-decyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]-2-(dimethylamino)-1,3-diazinane-4,6-dione (PubChem CID 72637115) has the molecular formula C49H67N5O2S2 and a molecular weight of 822.24 g/mol. Its IUPAC name is 5-[2,5-bis[2-(3-decyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]-2-(dimethylamino)-1,3-diazinane-4,6-dione.
| Compound Name | 5-[2,5-bis[2-(3-decyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]-2-(dimethylamino)-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 72637115 |
| Molecular Formula | C49H67N5O2S2 |
| Molecular Weight | 822.24 g/mol |
| Exact Mass | 821.47 |
| IUPAC Name | 5-[2,5-bis[2-(3-decyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclopentylidene]-2-(dimethylamino)-1,3-diazinane-4,6-dione |
| SMILES | CCCCCCCCCCN1C(=CC=C2CCC(=CC=C3Sc4ccccc4N3CCCCCCCCCC)C2=C2C(=O)NC(N(C)C)NC2=O)Sc2ccccc21 |
| InChI | InChI=1S/C49H67N5O2S2/c1-5-7-9-11-13-15-17-23-35-53-39-25-19-21-27-41(39)57-43(53)33-31-37-29-30-38(45(37)46-47(55)50-49(52(3)4)51-48(46)56)32-34-44-54(40-26-20-22-28-42(40)58-44)36-24-18-16-14-12-10-8-6-2/h19-22,25-28,31-34,49H,5-18,23-24,29-30,35-36H2,1-4H3,(H,50,55)(H,51,56) |
| InChIKey | WKYZVIVPOKVZBJ-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.24 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|